C19H26ClN3O3 — CID 124705270
3-[(2S)-1-[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]piperidin-2-yl]propanoic acid (PubChem CID 124705270) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-[(2S)-1-[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]piperidin-2-yl]propanoic acid.
| Compound Name | 3-[(2S)-1-[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 124705270 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[(2S)-1-[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]piperidin-2-yl]propanoic acid |
| SMILES | O=C(O)CC[C@@H]1CCCCN1C(=O)C1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C19H26ClN3O3/c20-15-4-6-17(21-13-15)22-11-8-14(9-12-22)19(26)23-10-2-1-3-16(23)5-7-18(24)25/h4,6,13-14,16H,1-3,5,7-12H2,(H,24,25)/t16-/m0/s1 |
| InChIKey | JATBVEGUCMXEPY-INIZCTEOSA-N |
| XLogP | 3.20 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |