C10H14FNO — CID 124705479
(1R)-1-(2-ethoxyphenyl)-2-fluoroethanamine (PubChem CID 124705479) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is (1R)-1-(2-ethoxyphenyl)-2-fluoroethanamine.
| Compound Name | (1R)-1-(2-ethoxyphenyl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 124705479 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (1R)-1-(2-ethoxyphenyl)-2-fluoroethanamine |
| SMILES | CCOc1ccccc1[C@@H](N)CF |
| InChI | InChI=1S/C10H14FNO/c1-2-13-10-6-4-3-5-8(10)9(12)7-11/h3-6,9H,2,7,12H2,1H3/t9-/m0/s1 |
| InChIKey | VWNBBRCCOJUIOM-VIFPVBQESA-N |
| XLogP | 2.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |