C9H17NS2 — CID 124705673
(2R,4R)-2,4,6-triethyl-4H-1,3,5-dithiazine (PubChem CID 124705673) has the molecular formula C9H17NS2 and a molecular weight of 203.38 g/mol. Its IUPAC name is (2R,4R)-2,4,6-triethyl-4H-1,3,5-dithiazine.
| Compound Name | (2R,4R)-2,4,6-triethyl-4H-1,3,5-dithiazine |
|---|---|
| PubChem CID | 124705673 |
| Molecular Formula | C9H17NS2 |
| Molecular Weight | 203.38 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (2R,4R)-2,4,6-triethyl-4H-1,3,5-dithiazine |
| SMILES | CCC1=N[C@@H](CC)S[C@@H](CC)S1 |
| InChI | InChI=1S/C9H17NS2/c1-4-7-10-8(5-2)12-9(6-3)11-7/h7,9H,4-6H2,1-3H3/t7-,9-/m1/s1 |
| InChIKey | OTBAROKLHZCHGJ-VXNVDRBHSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |