About tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate
tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate (PubChem CID 124705952) has the molecular formula C15H26N2O4
and a molecular weight of 298.38 g/mol. Its IUPAC name is tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
| PubChem CID | 124705952 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
| SMILES | CC(=O)[C@H]1C(=O)N(C)[C@H](C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O4/c1-9(18)10-11(19)16(8)12(14(2,3)4)17(10)13(20)21-15(5,6)7/h10,12H,1-8H3/t10-,12-/m0/s1 |
| InChIKey | LFTQBCMOBCEKTQ-JQWIXIFHSA-N |
| XLogP | 2.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate (CID 124705952) is tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate is CC(=O)[C@H]1C(=O)N(C)[C@H](C(C)(C)C)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate?
The InChIKey is LFTQBCMOBCEKTQ-JQWIXIFHSA-N. The full InChI is InChI=1S/C15H26N2O4/c1-9(18)10-11(19)16(8)12(14(2,3)4)17(10)13(20)21-15(5,6)7/h10,12H,1-8H3/t10-,12-/m0/s1.
What are the key properties of tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate?
tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate has a molecular weight of 298.38 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,5S)-5-acetyl-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate is sourced from PubChem (CID 124705952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).