C13H19N — CID 124706723
(2R)-2-[(4-methylphenyl)methyl]pent-4-en-1-amine (PubChem CID 124706723) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (2R)-2-[(4-methylphenyl)methyl]pent-4-en-1-amine.
| Compound Name | (2R)-2-[(4-methylphenyl)methyl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 124706723 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2R)-2-[(4-methylphenyl)methyl]pent-4-en-1-amine |
| SMILES | C=CC[C@@H](CN)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C13H19N/c1-3-4-13(10-14)9-12-7-5-11(2)6-8-12/h3,5-8,13H,1,4,9-10,14H2,2H3/t13-/m1/s1 |
| InChIKey | FTGNMLVDKHIOCX-CYBMUJFWSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|