About 5-(chloromethyl)-3,4-dihydro-1H-isochromene
5-(chloromethyl)-3,4-dihydro-1H-isochromene (PubChem CID 124706944) has the molecular formula C10H11ClO
and a molecular weight of 182.65 g/mol. Its IUPAC name is 5-(chloromethyl)-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 5-(chloromethyl)-3,4-dihydro-1H-isochromene |
| PubChem CID | 124706944 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 5-(chloromethyl)-3,4-dihydro-1H-isochromene |
| SMILES | ClCc1cccc2c1CCOC2 |
| InChI | InChI=1S/C10H11ClO/c11-6-8-2-1-3-9-7-12-5-4-10(8)9/h1-3H,4-7H2 |
| InChIKey | JCVBDQNLPIIWIF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-3,4-dihydro-1H-isochromene?
The IUPAC name of 5-(chloromethyl)-3,4-dihydro-1H-isochromene (CID 124706944) is 5-(chloromethyl)-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 5-(chloromethyl)-3,4-dihydro-1H-isochromene?
The canonical SMILES for 5-(chloromethyl)-3,4-dihydro-1H-isochromene is ClCc1cccc2c1CCOC2.
What is the InChIKey of 5-(chloromethyl)-3,4-dihydro-1H-isochromene?
The InChIKey is JCVBDQNLPIIWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO/c11-6-8-2-1-3-9-7-12-5-4-10(8)9/h1-3H,4-7H2.
What are the key properties of 5-(chloromethyl)-3,4-dihydro-1H-isochromene?
5-(chloromethyl)-3,4-dihydro-1H-isochromene has a molecular weight of 182.65 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 124706944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).