C9H14O3 — CID 124707910
(2S,4Z)-2-(hydroxymethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 124707910) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2S,4Z)-2-(hydroxymethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,4Z)-2-(hydroxymethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 124707910 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2S,4Z)-2-(hydroxymethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | O=C1CCC/C=C\C[C@@H](CO)O1 |
| InChI | InChI=1S/C9H14O3/c10-7-8-5-3-1-2-4-6-9(11)12-8/h1,3,8,10H,2,4-7H2/b3-1-/t8-/m0/s1 |
| InChIKey | VPYUIGAQJZHEPW-CJKINAQCSA-N |
| XLogP | 1.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|