C15H26O3 — CID 124708193
(1R,4S,6R,7R,8S,11S)-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol (PubChem CID 124708193) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1R,4S,6R,7R,8S,11S)-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol.
| Compound Name | (1R,4S,6R,7R,8S,11S)-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol |
|---|---|
| PubChem CID | 124708193 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1R,4S,6R,7R,8S,11S)-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)O[C@@H]2CC[C@]2(C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C15H26O3/c1-9(2)10-5-7-14(3)11(17-14)6-8-15(4)13(18-15)12(10)16/h9-13,16H,5-8H2,1-4H3/t10-,11+,12+,13+,14-,15-/m0/s1 |
| InChIKey | CZZAIHWBOUXBPS-ZYIYBEKCSA-N |
| XLogP | 2.51 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|