C11H11NO3 — CID 124708708
methyl (4R)-3-oxo-2,4-dihydro-1H-isoquinoline-4-carboxylate (PubChem CID 124708708) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl (4R)-3-oxo-2,4-dihydro-1H-isoquinoline-4-carboxylate.
| Compound Name | methyl (4R)-3-oxo-2,4-dihydro-1H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 124708708 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methyl (4R)-3-oxo-2,4-dihydro-1H-isoquinoline-4-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)NCc2ccccc21 |
| InChI | InChI=1S/C11H11NO3/c1-15-11(14)9-8-5-3-2-4-7(8)6-12-10(9)13/h2-5,9H,6H2,1H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | ARSONIHTHTWDIB-SECBINFHSA-N |
| XLogP | 0.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|