About cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine
cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine (PubChem CID 124708997) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine |
| PubChem CID | 124708997 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine |
| SMILES | C[C@@H]1CCCC[C@@H]1N[C@H]1CCC[C@H]1C |
| InChI | InChI=1S/C13H25N/c1-10-6-3-4-8-12(10)14-13-9-5-7-11(13)2/h10-14H,3-9H2,1-2H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | FROHJNSTPMAIBU-NDBYEHHHSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine?
The IUPAC name of cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine (CID 124708997) is cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine.
What is the SMILES notation for cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine?
The canonical SMILES for cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine is C[C@@H]1CCCC[C@@H]1N[C@H]1CCC[C@H]1C.
What is the InChIKey of cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine?
The InChIKey is FROHJNSTPMAIBU-NDBYEHHHSA-N. The full InChI is InChI=1S/C13H25N/c1-10-6-3-4-8-12(10)14-13-9-5-7-11(13)2/h10-14H,3-9H2,1-2H3/t10-,11-,12+,13+/m1/s1.
What are the key properties of cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine?
cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine has a molecular weight of 195.35 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-methyl-N-[(1S,2R)-2-methylcyclopentyl]cyclohexan-1-amine is sourced from PubChem (CID 124708997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).