C10H14N2O — CID 124709131
(2S,3R)-2-pyridin-4-yloxan-3-amine (PubChem CID 124709131) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (2S,3R)-2-pyridin-4-yloxan-3-amine.
| Compound Name | (2S,3R)-2-pyridin-4-yloxan-3-amine |
|---|---|
| PubChem CID | 124709131 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (2S,3R)-2-pyridin-4-yloxan-3-amine |
| SMILES | N[C@@H]1CCCO[C@H]1c1ccncc1 |
| InChI | InChI=1S/C10H14N2O/c11-9-2-1-7-13-10(9)8-3-5-12-6-4-8/h3-6,9-10H,1-2,7,11H2/t9-,10+/m1/s1 |
| InChIKey | HCFJJELKYFVCQU-ZJUUUORDSA-N |
| XLogP | 1.26 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |