C10H18N2O — CID 124709549
(5S,9S,13S)-4-oxa-1,10-diazatricyclo[7.3.1.05,13]tridecane (PubChem CID 124709549) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (5S,9S,13S)-4-oxa-1,10-diazatricyclo[7.3.1.05,13]tridecane.
| Compound Name | (5S,9S,13S)-4-oxa-1,10-diazatricyclo[7.3.1.05,13]tridecane |
|---|---|
| PubChem CID | 124709549 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (5S,9S,13S)-4-oxa-1,10-diazatricyclo[7.3.1.05,13]tridecane |
| SMILES | C1C[C@@H]2NCCN3CCO[C@@H](C1)[C@H]23 |
| InChI | InChI=1S/C10H18N2O/c1-2-8-10-9(3-1)13-7-6-12(10)5-4-11-8/h8-11H,1-7H2/t8-,9-,10-/m0/s1 |
| InChIKey | LTOFDPPBDAZZBV-GUBZILKMSA-N |
| XLogP | 0.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |