About (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane
(1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane (PubChem CID 124709613) has the molecular formula C7H11F2N
and a molecular weight of 147.17 g/mol. Its IUPAC name is (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane |
| PubChem CID | 124709613 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane |
| SMILES | C[C@@]12CCNC[C@@H]1C2(F)F |
| InChI | InChI=1S/C7H11F2N/c1-6-2-3-10-4-5(6)7(6,8)9/h5,10H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | MRRJNXMDOXBSNV-NTSWFWBYSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane?
The IUPAC name of (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane (CID 124709613) is (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane.
What is the SMILES notation for (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane?
The canonical SMILES for (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane is C[C@@]12CCNC[C@@H]1C2(F)F.
What is the InChIKey of (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane?
The InChIKey is MRRJNXMDOXBSNV-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H11F2N/c1-6-2-3-10-4-5(6)7(6,8)9/h5,10H,2-4H2,1H3/t5-,6+/m0/s1.
What are the key properties of (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane?
(1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane has a molecular weight of 147.17 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane is sourced from PubChem (CID 124709613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).