C13H16N2O3 — CID 124709648
(2R,3R)-4-ethyl-5-oxo-3-phenylmorpholine-2-carboxamide (PubChem CID 124709648) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2R,3R)-4-ethyl-5-oxo-3-phenylmorpholine-2-carboxamide.
| Compound Name | (2R,3R)-4-ethyl-5-oxo-3-phenylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 124709648 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2R,3R)-4-ethyl-5-oxo-3-phenylmorpholine-2-carboxamide |
| SMILES | CCN1C(=O)CO[C@@H](C(N)=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H16N2O3/c1-2-15-10(16)8-18-12(13(14)17)11(15)9-6-4-3-5-7-9/h3-7,11-12H,2,8H2,1H3,(H2,14,17)/t11-,12-/m1/s1 |
| InChIKey | NBILJQGMAXBBCA-VXGBXAGGSA-N |
| XLogP | 0.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |