C7H13NO — CID 124709870
(2R,3S)-2-ethenyloxan-3-amine (PubChem CID 124709870) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (2R,3S)-2-ethenyloxan-3-amine.
| Compound Name | (2R,3S)-2-ethenyloxan-3-amine |
|---|---|
| PubChem CID | 124709870 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (2R,3S)-2-ethenyloxan-3-amine |
| SMILES | C=C[C@H]1OCCC[C@@H]1N |
| InChI | InChI=1S/C7H13NO/c1-2-7-6(8)4-3-5-9-7/h2,6-7H,1,3-5,8H2/t6-,7+/m0/s1 |
| InChIKey | PNTQMYFDQAIZFP-NKWVEPMBSA-N |
| XLogP | 0.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|