cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride

C5H8ClFO2S — CID 124710598

IUPACcis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)[C@@H]1CCC[C@@H]1F
InChIInChI=1S/C5H8ClFO2S/c6-10(8,9)5-3-1-2-4(5)7/h4-5H,1-3H2/t4-,5+/m0/s1
InChIKeyXKSZTDRWWIVGEF-CRCLSJGQSA-N
MW186.63 g/mol
LogP1.45
Rot. Bonds1

About cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride

cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride (PubChem CID 124710598) has the molecular formula C5H8ClFO2S and a molecular weight of 186.63 g/mol. Its IUPAC name is cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride.

Molecular Properties

Compound Namecis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride
PubChem CID124710598
Molecular FormulaC5H8ClFO2S
Molecular Weight186.63 g/mol
Exact Mass185.99
IUPAC Namecis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)[C@@H]1CCC[C@@H]1F
InChIInChI=1S/C5H8ClFO2S/c6-10(8,9)5-3-1-2-4(5)7/h4-5H,1-3H2/t4-,5+/m0/s1
InChIKeyXKSZTDRWWIVGEF-CRCLSJGQSA-N
XLogP1.45
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.63
LogP ≤ 51.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride?
The IUPAC name of cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride (CID 124710598) is cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride.
What is the SMILES notation for cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride?
The canonical SMILES for cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride is O=S(=O)(Cl)[C@@H]1CCC[C@@H]1F.
What is the InChIKey of cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride?
The InChIKey is XKSZTDRWWIVGEF-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H8ClFO2S/c6-10(8,9)5-3-1-2-4(5)7/h4-5H,1-3H2/t4-,5+/m0/s1.
What are the key properties of cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride?
cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride has a molecular weight of 186.63 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-fluorocyclopentane-1-sulfonyl chloride is sourced from PubChem (CID 124710598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).