C21H20O8 — CID 124711009
3-phenyl-7-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one (PubChem CID 124711009) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is 3-phenyl-7-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one.
| Compound Name | 3-phenyl-7-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 124711009 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-phenyl-7-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| SMILES | O=c1c(-c2ccccc2)coc2cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@@H]3O)ccc12 |
| InChI | InChI=1S/C21H20O8/c22-9-16-18(24)19(25)20(26)21(29-16)28-12-6-7-13-15(8-12)27-10-14(17(13)23)11-4-2-1-3-5-11/h1-8,10,16,18-22,24-26H,9H2/t16-,18+,19+,20+,21-/m1/s1 |
| InChIKey | CHVBPFQVSIWBOU-SDZDHKAXSA-N |
| XLogP | 0.64 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |