C20H18N4O4S2 — CID 124711884
(2S,6R,7S,9R,13R,14R)-4,11-dimethyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 124711884) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is (2S,6R,7S,9R,13R,14R)-4,11-dimethyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | (2S,6R,7S,9R,13R,14R)-4,11-dimethyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 124711884 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (2S,6R,7S,9R,13R,14R)-4,11-dimethyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | CN1C(=O)[C@@H]2[C@@H](C1=O)N1[C@@H](c3cccs3)[C@@H]3C(=O)N(C)C(=O)[C@@H]3N1[C@@H]2c1cccs1 |
| InChI | InChI=1S/C20H18N4O4S2/c1-21-17(25)11-13(9-5-3-7-29-9)24-16-12(18(26)22(2)20(16)28)14(10-6-4-8-30-10)23(24)15(11)19(21)27/h3-8,11-16H,1-2H3/t11-,12-,13-,14+,15+,16-/m0/s1 |
| InChIKey | SPHHDFIPWOIWAC-AYYATWNNSA-N |
| XLogP | 1.11 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|