C23H23N3O5S2 — CID 124712239
ethyl 3-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate (PubChem CID 124712239) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl 3-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate.
| Compound Name | ethyl 3-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate |
|---|---|
| PubChem CID | 124712239 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | ethyl 3-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate |
| SMILES | CCOC(=O)CCN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@H](c2cccnc2)c2sc(=O)[nH]c2S[C@H]31 |
| InChI | InChI=1S/C23H23N3O5S2/c1-2-31-13(27)5-7-26-21(28)16-11-8-12(17(16)22(26)29)18-15(11)14(10-4-3-6-24-9-10)19-20(32-18)25-23(30)33-19/h3-4,6,9,11-12,14-18H,2,5,7-8H2,1H3,(H,25,30)/t11-,12-,14+,15-,16+,17-,18-/m1/s1 |
| InChIKey | ZMEMPLSBDSDHMB-NSXCTHALSA-N |
| XLogP | 2.26 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|