C37H38N2O4 — CID 124714248
(2S)-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-3-phenylpropanamide (PubChem CID 124714248) has the molecular formula C37H38N2O4 and a molecular weight of 574.72 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 124714248 |
| Molecular Formula | C37H38N2O4 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (2S)-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-3-phenylpropanamide |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)[C@H](Cc3ccccc3)N3C(=O)[C@@H]4[C@H]5C=C[C@@H]([C@@H]6C[C@H]56)[C@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C37H38N2O4/c1-4-37(2,3)23-10-14-25(15-11-23)43-26-16-12-24(13-17-26)38-34(40)31(20-22-8-6-5-7-9-22)39-35(41)32-27-18-19-28(30-21-29(27)30)33(32)36(39)42/h5-19,27-33H,4,20-21H2,1-3H3,(H,38,40)/t27-,28-,29-,30+,31-,32+,33+/m0/s1 |
| InChIKey | JOXFXLOIRRDXNE-LDMBXAKTSA-N |
| XLogP | 6.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|