C14H17NO2S — CID 124714721
(1S,2R,11R,12S)-5-methyl-10λ6-thia-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene 10,10-dioxide (PubChem CID 124714721) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (1S,2R,11R,12S)-5-methyl-10λ6-thia-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene 10,10-dioxide.
| Compound Name | (1S,2R,11R,12S)-5-methyl-10λ6-thia-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene 10,10-dioxide |
|---|---|
| PubChem CID | 124714721 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (1S,2R,11R,12S)-5-methyl-10λ6-thia-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene 10,10-dioxide |
| SMILES | Cc1ccc2c(c1)[C@H]1[C@H]3CC[C@@H](C3)[C@H]1S(=O)(=O)N2 |
| InChI | InChI=1S/C14H17NO2S/c1-8-2-5-12-11(6-8)13-9-3-4-10(7-9)14(13)18(16,17)15-12/h2,5-6,9-10,13-15H,3-4,7H2,1H3/t9-,10-,13+,14+/m0/s1 |
| InChIKey | MWROONBPKINMAU-DUBDDPSESA-N |
| XLogP | 2.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |