C29H25NO4 — CID 124714764
benzyl (1R,5R,6R,7R)-3-benzhydryl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 124714764) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is benzyl (1R,5R,6R,7R)-3-benzhydryl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | benzyl (1R,5R,6R,7R)-3-benzhydryl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 124714764 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | benzyl (1R,5R,6R,7R)-3-benzhydryl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1[C@H]2C(=O)N(C(c3ccccc3)c3ccccc3)C[C@@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C29H25NO4/c31-27-25-24(28(32)33-18-20-10-4-1-5-11-20)23-16-17-29(25,34-23)19-30(27)26(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-17,23-26H,18-19H2/t23-,24+,25+,29+/m1/s1 |
| InChIKey | MZUNZSJTBGUKTH-SGDZTBBFSA-N |
| XLogP | 4.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|