C23H31NO3 — CID 124714971
(1R,2S,3R,4R)-7-propan-2-ylidene-3-[[(1S)-1-(4-propylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 124714971) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (1R,2S,3R,4R)-7-propan-2-ylidene-3-[[(1S)-1-(4-propylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-7-propan-2-ylidene-3-[[(1S)-1-(4-propylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 124714971 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (1R,2S,3R,4R)-7-propan-2-ylidene-3-[[(1S)-1-(4-propylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCCc1ccc([C@H](C)NC(=O)[C@H]2[C@@H](C(=O)O)[C@H]3CC[C@H]2C3=C(C)C)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-5-6-15-7-9-16(10-8-15)14(4)24-22(25)20-17-11-12-18(19(17)13(2)3)21(20)23(26)27/h7-10,14,17-18,20-21H,5-6,11-12H2,1-4H3,(H,24,25)(H,26,27)/t14-,17-,18-,20+,21-/m0/s1 |
| InChIKey | NKEVONKMIIRLDD-FFQWIGKUSA-N |
| XLogP | 4.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|