C27H21ClN2O8 — CID 124715638
[2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 2-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate (PubChem CID 124715638) has the molecular formula C27H21ClN2O8 and a molecular weight of 536.92 g/mol. Its IUPAC name is [2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 2-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate.
| Compound Name | [2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 2-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
|---|---|
| PubChem CID | 124715638 |
| Molecular Formula | C27H21ClN2O8 |
| Molecular Weight | 536.92 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | [2-[4-(2-chloro-6-nitrophenoxy)phenyl]-2-oxoethyl] 2-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@H]34)[C@@H]2C1=O)OCC(=O)c1ccc(Oc2c(Cl)cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H21ClN2O8/c28-19-2-1-3-20(30(35)36)25(19)38-14-6-4-13(5-7-14)21(31)12-37-22(32)11-29-26(33)23-15-8-9-16(18-10-17(15)18)24(23)27(29)34/h1-9,15-18,23-24H,10-12H2/t15-,16-,17-,18+,23-,24+/m0/s1 |
| InChIKey | PFJPBDXUNAEFCN-LBOBVIFKSA-N |
| XLogP | 3.82 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.92 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|