C23H22N2O4S — CID 124716477
(1R,2R,3S,4R)-3-[(3-carbamoyl-4,5-dihydrobenzo[g][1]benzothiol-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 124716477) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is (1R,2R,3S,4R)-3-[(3-carbamoyl-4,5-dihydrobenzo[g][1]benzothiol-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4R)-3-[(3-carbamoyl-4,5-dihydrobenzo[g][1]benzothiol-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 124716477 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (1R,2R,3S,4R)-3-[(3-carbamoyl-4,5-dihydrobenzo[g][1]benzothiol-2-yl)carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | NC(=O)c1c(NC(=O)[C@@H]2[C@H](C(=O)O)[C@H]3C=C[C@H]2CC3)sc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C23H22N2O4S/c24-20(26)18-15-10-9-11-3-1-2-4-14(11)19(15)30-22(18)25-21(27)16-12-5-7-13(8-6-12)17(16)23(28)29/h1-5,7,12-13,16-17H,6,8-10H2,(H2,24,26)(H,25,27)(H,28,29)/t12-,13-,16-,17+/m0/s1 |
| InChIKey | SEYHZYZQXTWQKY-MGBSGCIJSA-N |
| XLogP | 3.46 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|