C29H30N2O4 — CID 124716567
N-[4-(4-tert-butylphenoxy)phenyl]-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetamide (PubChem CID 124716567) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenoxy)phenyl]-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetamide.
| Compound Name | N-[4-(4-tert-butylphenoxy)phenyl]-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetamide |
|---|---|
| PubChem CID | 124716567 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[4-(4-tert-butylphenoxy)phenyl]-2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetamide |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(NC(=O)CN3C(=O)[C@@H]4[C@H]5C=C[C@@H]([C@@H]6C[C@H]56)[C@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-29(2,3)16-4-8-18(9-5-16)35-19-10-6-17(7-11-19)30-24(32)15-31-27(33)25-20-12-13-21(23-14-22(20)23)26(25)28(31)34/h4-13,20-23,25-26H,14-15H2,1-3H3,(H,30,32)/t20-,21-,22-,23+,25+,26+/m0/s1 |
| InChIKey | SKNUNIQCENIODL-IVFQASMKSA-N |
| XLogP | 4.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|