C23H20ClNO4 — CID 124717092
(1S,2R,4R,5S,6R,7R)-7-[[4-(2-chlorophenoxy)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid (PubChem CID 124717092) has the molecular formula C23H20ClNO4 and a molecular weight of 409.87 g/mol. Its IUPAC name is (1S,2R,4R,5S,6R,7R)-7-[[4-(2-chlorophenoxy)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid.
| Compound Name | (1S,2R,4R,5S,6R,7R)-7-[[4-(2-chlorophenoxy)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 124717092 |
| Molecular Formula | C23H20ClNO4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (1S,2R,4R,5S,6R,7R)-7-[[4-(2-chlorophenoxy)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C=C[C@@H]([C@@H]3C[C@@H]23)[C@H]1C(=O)Nc1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H20ClNO4/c24-18-3-1-2-4-19(18)29-13-7-5-12(6-8-13)25-22(26)20-14-9-10-15(17-11-16(14)17)21(20)23(27)28/h1-10,14-17,20-21H,11H2,(H,25,26)(H,27,28)/t14-,15-,16-,17-,20+,21+/m0/s1 |
| InChIKey | VWUDQRBJMAYMFX-OPLYSGQSSA-N |
| XLogP | 4.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|