C29H20BrNO7 — CID 124717807
ethyl 4-[(1R,3aS,6aS)-1-(2-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]benzoate (PubChem CID 124717807) has the molecular formula C29H20BrNO7 and a molecular weight of 574.38 g/mol. Its IUPAC name is ethyl 4-[(1R,3aS,6aS)-1-(2-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]benzoate.
| Compound Name | ethyl 4-[(1R,3aS,6aS)-1-(2-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]benzoate |
|---|---|
| PubChem CID | 124717807 |
| Molecular Formula | C29H20BrNO7 |
| Molecular Weight | 574.38 g/mol |
| Exact Mass | 573.04 |
| IUPAC Name | ethyl 4-[(1R,3aS,6aS)-1-(2-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](c4ccccc4Br)OC4(C(=O)c5ccccc5C4=O)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H20BrNO7/c1-2-37-28(36)15-11-13-16(14-12-15)31-26(34)21-22(27(31)35)29(38-23(21)19-9-5-6-10-20(19)30)24(32)17-7-3-4-8-18(17)25(29)33/h3-14,21-23H,2H2,1H3/t21-,22+,23-/m0/s1 |
| InChIKey | ZASFDPRXZLMBFX-ZRBLBEILSA-N |
| XLogP | 4.32 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|