C25H21BrN2O3 — CID 124717808
N-(4-bromo-2-methylphenyl)-3-[(1S,2R,6S,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide (PubChem CID 124717808) has the molecular formula C25H21BrN2O3 and a molecular weight of 477.36 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-[(1S,2R,6S,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-[(1S,2R,6S,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide |
|---|---|
| PubChem CID | 124717808 |
| Molecular Formula | C25H21BrN2O3 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-[(1S,2R,6S,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)c1cccc(N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@H]45)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C25H21BrN2O3/c1-12-9-14(26)5-8-20(12)27-23(29)13-3-2-4-15(10-13)28-24(30)21-16-6-7-17(19-11-18(16)19)22(21)25(28)31/h2-10,16-19,21-22H,11H2,1H3,(H,27,29)/t16-,17-,18-,19+,21-,22+/m0/s1 |
| InChIKey | ZATXHPXIFNMCCP-DVBWKPSCSA-N |
| XLogP | 4.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|