C22H32N2O8S — CID 124717878
[(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4-phenylpiperazine-1-sulfonate (PubChem CID 124717878) has the molecular formula C22H32N2O8S and a molecular weight of 484.57 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4-phenylpiperazine-1-sulfonate.
| Compound Name | [(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4-phenylpiperazine-1-sulfonate |
|---|---|
| PubChem CID | 124717878 |
| Molecular Formula | C22H32N2O8S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4-phenylpiperazine-1-sulfonate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@]3(COS(=O)(=O)N4CCN(c5ccccc5)CC4)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C22H32N2O8S/c1-20(2)29-17-14-27-22(19(18(17)30-20)31-21(3,4)32-22)15-28-33(25,26)24-12-10-23(11-13-24)16-8-6-5-7-9-16/h5-9,17-19H,10-15H2,1-4H3/t17-,18-,19+,22-/m1/s1 |
| InChIKey | ZEXXUWJZHBBSKF-NXWNEQKCSA-N |
| XLogP | 1.47 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |