C29H25N3O3 — CID 124718100
(3aR,7aR)-2-[2-[(3S)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 124718100) has the molecular formula C29H25N3O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is (3aR,7aR)-2-[2-[(3S)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[2-[(3S)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124718100 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (3aR,7aR)-2-[2-[(3S)-5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1CC(=O)N1N=C(c2ccc3ccccc3c2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H25N3O3/c33-27(18-31-28(34)23-12-6-7-13-24(23)29(31)35)32-26(20-9-2-1-3-10-20)17-25(30-32)22-15-14-19-8-4-5-11-21(19)16-22/h1-11,14-16,23-24,26H,12-13,17-18H2/t23-,24-,26+/m1/s1 |
| InChIKey | ATYURKFUQFCKKA-MZKUHISZSA-N |
| XLogP | 4.47 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|