C15H14Br2N2O2 — CID 124718293
(1R,2S,6R,7R,8S,9S)-8,9-dibromo-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 124718293) has the molecular formula C15H14Br2N2O2 and a molecular weight of 414.10 g/mol. Its IUPAC name is (1R,2S,6R,7R,8S,9S)-8,9-dibromo-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7R,8S,9S)-8,9-dibromo-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 124718293 |
| Molecular Formula | C15H14Br2N2O2 |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | (1R,2S,6R,7R,8S,9S)-8,9-dibromo-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@H](Br)[C@H]4Br)[C@@H]3C2=O)n1 |
| InChI | InChI=1S/C15H14Br2N2O2/c1-6-3-2-4-9(18-6)19-14(20)10-7-5-8(11(10)15(19)21)13(17)12(7)16/h2-4,7-8,10-13H,5H2,1H3/t7-,8-,10-,11+,12+,13+/m1/s1 |
| InChIKey | BFBQOWQCOPVYPS-PIQGMWHKSA-N |
| XLogP | 2.67 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|