C20H34N6O2S2 — CID 124718788
2-[[4-amino-5-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]sulfanyl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone (PubChem CID 124718788) has the molecular formula C20H34N6O2S2 and a molecular weight of 454.67 g/mol. Its IUPAC name is 2-[[4-amino-5-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]sulfanyl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone.
| Compound Name | 2-[[4-amino-5-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]sulfanyl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124718788 |
| Molecular Formula | C20H34N6O2S2 |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-[[4-amino-5-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]sulfanyl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)CSc2nnc(SCC(=O)N3C[C@H](C)C[C@@H](C)C3)n2N)C1 |
| InChI | InChI=1S/C20H34N6O2S2/c1-13-5-14(2)8-24(7-13)17(27)11-29-19-22-23-20(26(19)21)30-12-18(28)25-9-15(3)6-16(4)10-25/h13-16H,5-12,21H2,1-4H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | DTEPMRNWPWTWOK-KLHDSHLOSA-N |
| XLogP | 2.19 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |