C18H29NO4 — CID 124719047
(1R,2S,3S,4R)-3-(decylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 124719047) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-(decylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4R)-3-(decylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 124719047 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (1R,2S,3S,4R)-3-(decylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCCCCCCCCCNC(=O)[C@H]1[C@H](C(=O)O)[C@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C18H29NO4/c1-2-3-4-5-6-7-8-9-12-19-17(20)15-13-10-11-14(23-13)16(15)18(21)22/h10-11,13-16H,2-9,12H2,1H3,(H,19,20)(H,21,22)/t13-,14-,15-,16-/m1/s1 |
| InChIKey | GEFQZXHANGGTQE-KLHDSHLOSA-N |
| XLogP | 2.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|