C18H31NO4 — CID 124719753
(1R,2S,3R,4R)-3-(dipentylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 124719753) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-(dipentylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-(dipentylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 124719753 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (1R,2S,3R,4R)-3-(dipentylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCCCCN(CCCCC)C(=O)[C@@H]1[C@H](C(=O)O)[C@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C18H31NO4/c1-3-5-7-11-19(12-8-6-4-2)17(20)15-13-9-10-14(23-13)16(15)18(21)22/h13-16H,3-12H2,1-2H3,(H,21,22)/t13-,14-,15+,16-/m1/s1 |
| InChIKey | HVCLRHYUTXIILF-LVQVYYBASA-N |
| XLogP | 3.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|