C14H12Cl4O4 — CID 124720136
(1R,2R,3S,5S,6R,7S,9S,10R)-2,3,5,6-tetrachloro-4,4-dimethoxy-1-methylpentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione (PubChem CID 124720136) has the molecular formula C14H12Cl4O4 and a molecular weight of 386.06 g/mol. Its IUPAC name is (1R,2R,3S,5S,6R,7S,9S,10R)-2,3,5,6-tetrachloro-4,4-dimethoxy-1-methylpentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione.
| Compound Name | (1R,2R,3S,5S,6R,7S,9S,10R)-2,3,5,6-tetrachloro-4,4-dimethoxy-1-methylpentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione |
|---|---|
| PubChem CID | 124720136 |
| Molecular Formula | C14H12Cl4O4 |
| Molecular Weight | 386.06 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | (1R,2R,3S,5S,6R,7S,9S,10R)-2,3,5,6-tetrachloro-4,4-dimethoxy-1-methylpentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione |
| SMILES | COC1(OC)[C@@]2(Cl)[C@@H]3C(=O)[C@H]4[C@]2(Cl)[C@@]2(Cl)[C@@]4(C)C(=O)[C@@H]3[C@]12Cl |
| InChI | InChI=1S/C14H12Cl4O4/c1-9-7-6(19)4-5(8(9)20)11(16)13(9,18)12(7,17)10(4,15)14(11,21-2)22-3/h4-5,7H,1-3H3/t4-,5+,7+,9+,10+,11+,12+,13+/m0/s1 |
| InChIKey | IYKMPUJZXOUTKN-KECVYFHOSA-N |
| XLogP | 1.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.06 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|