C27H27N3O5 — CID 124720419
(5S,10bR)-2-(3,4-dimethoxyphenyl)-9-nitro-5-(4-propan-2-ylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 124720419) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is (5S,10bR)-2-(3,4-dimethoxyphenyl)-9-nitro-5-(4-propan-2-ylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5S,10bR)-2-(3,4-dimethoxyphenyl)-9-nitro-5-(4-propan-2-ylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 124720419 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (5S,10bR)-2-(3,4-dimethoxyphenyl)-9-nitro-5-(4-propan-2-ylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | COc1ccc(C2=NN3[C@H](C2)c2cc([N+](=O)[O-])ccc2O[C@H]3c2ccc(C(C)C)cc2)cc1OC |
| InChI | InChI=1S/C27H27N3O5/c1-16(2)17-5-7-18(8-6-17)27-29-23(21-14-20(30(31)32)10-12-24(21)35-27)15-22(28-29)19-9-11-25(33-3)26(13-19)34-4/h5-14,16,23,27H,15H2,1-4H3/t23-,27+/m1/s1 |
| InChIKey | KOFZBBMMJRCZTQ-KCWPFWIISA-N |
| XLogP | 5.98 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|