C32H27NO4 — CID 124720811
(4-phenylphenyl) (2S)-2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoate (PubChem CID 124720811) has the molecular formula C32H27NO4 and a molecular weight of 489.57 g/mol. Its IUPAC name is (4-phenylphenyl) (2S)-2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoate.
| Compound Name | (4-phenylphenyl) (2S)-2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 124720811 |
| Molecular Formula | C32H27NO4 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (4-phenylphenyl) (2S)-2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoate |
| SMILES | O=C(Oc1ccc(-c2ccccc2)cc1)[C@H](Cc1ccccc1)N1C(=O)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@H]2C1=O |
| InChI | InChI=1S/C32H27NO4/c34-30-28-23-15-16-24(26-18-25(23)26)29(28)31(35)33(30)27(17-19-7-3-1-4-8-19)32(36)37-22-13-11-21(12-14-22)20-9-5-2-6-10-20/h1-16,23-29H,17-18H2/t23-,24-,25-,26-,27-,28+,29+/m0/s1 |
| InChIKey | LRVAZUSOZXJPNF-UTUWTIBCSA-N |
| XLogP | 4.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|