C21H36N2O2 — CID 124721262
(2S)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylbutan-1-one (PubChem CID 124721262) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2S)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylbutan-1-one.
| Compound Name | (2S)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 124721262 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (2S)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylbutan-1-one |
| SMILES | CC(C)[C@@H](C(=O)N1CCC[C@]2(CC=CCC2)C1)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C21H36N2O2/c1-16(2)19(23-13-17(3)25-18(4)14-23)20(24)22-12-8-11-21(15-22)9-6-5-7-10-21/h5-6,16-19H,7-15H2,1-4H3/t17-,18+,19-,21+/m0/s1 |
| InChIKey | AAXACJMGJMIZTL-YOUFYPILSA-N |
| XLogP | 3.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|