C18H19NO5 — CID 124722509
ethyl (1R,5R,6R,7R)-3-(2-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 124722509) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is ethyl (1R,5R,6R,7R)-3-(2-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | ethyl (1R,5R,6R,7R)-3-(2-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 124722509 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | ethyl (1R,5R,6R,7R)-3-(2-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)N(c3ccccc3OC)C[C@@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C18H19NO5/c1-3-23-17(21)14-13-8-9-18(24-13)10-19(16(20)15(14)18)11-6-4-5-7-12(11)22-2/h4-9,13-15H,3,10H2,1-2H3/t13-,14+,15+,18+/m1/s1 |
| InChIKey | RLIPVWRVUCZGPJ-LLDVTBCESA-N |
| XLogP | 1.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|