C18H20O2 — CID 124722720
(1R,2R,3S,5S,6R,7R,8S,9S,10R,11R)-11-methoxy-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol (PubChem CID 124722720) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (1R,2R,3S,5S,6R,7R,8S,9S,10R,11R)-11-methoxy-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol.
| Compound Name | (1R,2R,3S,5S,6R,7R,8S,9S,10R,11R)-11-methoxy-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol |
|---|---|
| PubChem CID | 124722720 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (1R,2R,3S,5S,6R,7R,8S,9S,10R,11R)-11-methoxy-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol |
| SMILES | CO[C@H]1[C@@H]2[C@@H]3[C@@H]4C[C@H]5[C@H]3[C@H]2[C@](O)(c2ccccc2)[C@@H]5[C@@H]41 |
| InChI | InChI=1S/C18H20O2/c1-20-17-13-9-7-10-12-11(9)14(17)16(12)18(19,15(10)13)8-5-3-2-4-6-8/h2-6,9-17,19H,7H2,1H3/t9-,10-,11+,12+,13+,14+,15-,16+,17+,18-/m0/s1 |
| InChIKey | SNTKXUVTTFWCCW-PLCMCOLLSA-N |
| XLogP | 2.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |