C15H19NO — CID 124723653
(1S,2S,3S,7S,8R,10R)-N-(cyclopropylmethyl)pentacyclo[4.4.0.02,4.03,7.08,10]decane-9-carboxamide (PubChem CID 124723653) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (1S,2S,3S,7S,8R,10R)-N-(cyclopropylmethyl)pentacyclo[4.4.0.02,4.03,7.08,10]decane-9-carboxamide.
| Compound Name | (1S,2S,3S,7S,8R,10R)-N-(cyclopropylmethyl)pentacyclo[4.4.0.02,4.03,7.08,10]decane-9-carboxamide |
|---|---|
| PubChem CID | 124723653 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (1S,2S,3S,7S,8R,10R)-N-(cyclopropylmethyl)pentacyclo[4.4.0.02,4.03,7.08,10]decane-9-carboxamide |
| SMILES | O=C(NCC1CC1)C1[C@@H]2[C@H]3C4CC5[C@H]3[C@H]5[C@H]4[C@@H]12 |
| InChI | InChI=1S/C15H19NO/c17-15(16-4-5-1-2-5)14-12-10-7-3-6-8(10)9(6)11(7)13(12)14/h5-14H,1-4H2,(H,16,17)/t6?,7?,8-,9-,10-,11-,12+,13+,14?/m0/s1 |
| InChIKey | WZVNWIOAJICPLB-VXKHGAQVSA-N |
| XLogP | 1.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |