C31H32N2O5 — CID 124724532
butyl 4-[[(2S)-2-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoyl]amino]benzoate (PubChem CID 124724532) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is butyl 4-[[(2S)-2-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoyl]amino]benzoate.
| Compound Name | butyl 4-[[(2S)-2-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 124724532 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | butyl 4-[[(2S)-2-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-3-phenylpropanoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)[C@H](Cc2ccccc2)N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H32N2O5/c1-2-3-15-38-31(37)19-9-11-20(12-10-19)32-28(34)25(16-18-7-5-4-6-8-18)33-29(35)26-21-13-14-22(24-17-23(21)24)27(26)30(33)36/h4-14,21-27H,2-3,15-17H2,1H3,(H,32,34)/t21-,22-,23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | ZIZNATHHSSKKOM-FAFIDUEOSA-N |
| XLogP | 4.25 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|