C10H11BrN2O2 — CID 124725126
(5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole (PubChem CID 124725126) has the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. Its IUPAC name is (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole.
| Compound Name | (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole |
|---|---|
| PubChem CID | 124725126 |
| Molecular Formula | C10H11BrN2O2 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole |
| SMILES | O=[N+]([O-])CCc1c[nH]c2c1=C[C@H](Br)CC=2 |
| InChI | InChI=1S/C10H11BrN2O2/c11-8-1-2-10-9(5-8)7(6-12-10)3-4-13(14)15/h2,5-6,8,12H,1,3-4H2/t8-/m1/s1 |
| InChIKey | QWGMFSLXVCTWOE-MRVPVSSYSA-N |
| XLogP | 0.56 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|