About (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole
(5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole (PubChem CID 124725126) has the molecular formula C10H11BrN2O2
and a molecular weight of 271.11 g/mol. Its IUPAC name is (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole.
Molecular Properties
| Compound Name | (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole |
| PubChem CID | 124725126 |
| Molecular Formula | C10H11BrN2O2 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole |
| SMILES | O=[N+]([O-])CCc1c[nH]c2c1=C[C@H](Br)CC=2 |
| InChI | InChI=1S/C10H11BrN2O2/c11-8-1-2-10-9(5-8)7(6-12-10)3-4-13(14)15/h2,5-6,8,12H,1,3-4H2/t8-/m1/s1 |
| InChIKey | QWGMFSLXVCTWOE-MRVPVSSYSA-N |
| XLogP | 0.56 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole?
The IUPAC name of (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole (CID 124725126) is (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole.
What is the SMILES notation for (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole?
The canonical SMILES for (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole is O=[N+]([O-])CCc1c[nH]c2c1=C[C@H](Br)CC=2.
What is the InChIKey of (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole?
The InChIKey is QWGMFSLXVCTWOE-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H11BrN2O2/c11-8-1-2-10-9(5-8)7(6-12-10)3-4-13(14)15/h2,5-6,8,12H,1,3-4H2/t8-/m1/s1.
What are the key properties of (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole?
(5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole has a molecular weight of 271.11 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-bromo-3-(2-nitroethyl)-5,6-dihydro-1H-indole is sourced from PubChem (CID 124725126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).