C15H21ClN2O2S — CID 124725473
(9aS)-2-[(2-chlorophenyl)methylsulfonyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 124725473) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.86 g/mol. Its IUPAC name is (9aS)-2-[(2-chlorophenyl)methylsulfonyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | (9aS)-2-[(2-chlorophenyl)methylsulfonyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 124725473 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (9aS)-2-[(2-chlorophenyl)methylsulfonyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | O=S(=O)(Cc1ccccc1Cl)N1CCCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C15H21ClN2O2S/c16-15-7-2-1-5-13(15)12-21(19,20)18-10-4-9-17-8-3-6-14(17)11-18/h1-2,5,7,14H,3-4,6,8-12H2/t14-/m0/s1 |
| InChIKey | BEYYQKMBFNTKHP-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |