C15H26N4S — CID 124725480
(4aR,8aS)-4-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine (PubChem CID 124725480) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is (4aR,8aS)-4-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine.
| Compound Name | (4aR,8aS)-4-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
|---|---|
| PubChem CID | 124725480 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (4aR,8aS)-4-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
| SMILES | CC(C)(C)n1ncnc1CN1CCS[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H26N4S/c1-15(2,3)19-14(16-11-17-19)10-18-8-9-20-13-7-5-4-6-12(13)18/h11-13H,4-10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | BFCGLXHHVJDPIV-OLZOCXBDSA-N |
| XLogP | 2.89 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |