About [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea
[4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea (PubChem CID 124725983) has the molecular formula C20H26N4O
and a molecular weight of 338.46 g/mol. Its IUPAC name is [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea.
Molecular Properties
| Compound Name | [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea |
| PubChem CID | 124725983 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea |
| SMILES | Cc1cccnc1[C@H]1CCC[C@@H](Nc2ccc(CNC(N)=O)cc2)C1 |
| InChI | InChI=1S/C20H26N4O/c1-14-4-3-11-22-19(14)16-5-2-6-18(12-16)24-17-9-7-15(8-10-17)13-23-20(21)25/h3-4,7-11,16,18,24H,2,5-6,12-13H2,1H3,(H3,21,23,25)/t16-,18+/m0/s1 |
| InChIKey | BPBBGKWHCAOIHX-FUHWJXTLSA-N |
| XLogP | 3.70 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea?
The IUPAC name of [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea (CID 124725983) is [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea.
What is the SMILES notation for [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea?
The canonical SMILES for [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea is Cc1cccnc1[C@H]1CCC[C@@H](Nc2ccc(CNC(N)=O)cc2)C1.
What is the InChIKey of [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea?
The InChIKey is BPBBGKWHCAOIHX-FUHWJXTLSA-N. The full InChI is InChI=1S/C20H26N4O/c1-14-4-3-11-22-19(14)16-5-2-6-18(12-16)24-17-9-7-15(8-10-17)13-23-20(21)25/h3-4,7-11,16,18,24H,2,5-6,12-13H2,1H3,(H3,21,23,25)/t16-,18+/m0/s1.
What are the key properties of [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea?
[4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea has a molecular weight of 338.46 g/mol, XLogP of 3.70, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(1R,3S)-3-(3-methyl-2-pyridinyl)cyclohexyl]amino]phenyl]methylurea is sourced from PubChem (CID 124725983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).