C22H24N2O3 — CID 124726803
4-methoxy-N-[3-[[[(1R)-1-[(2R)-oxolan-2-yl]prop-2-ynyl]amino]methyl]phenyl]benzamide (PubChem CID 124726803) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-methoxy-N-[3-[[[(1R)-1-[(2R)-oxolan-2-yl]prop-2-ynyl]amino]methyl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[[[(1R)-1-[(2R)-oxolan-2-yl]prop-2-ynyl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 124726803 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-methoxy-N-[3-[[[(1R)-1-[(2R)-oxolan-2-yl]prop-2-ynyl]amino]methyl]phenyl]benzamide |
| SMILES | C#C[C@@H](NCc1cccc(NC(=O)c2ccc(OC)cc2)c1)[C@H]1CCCO1 |
| InChI | InChI=1S/C22H24N2O3/c1-3-20(21-8-5-13-27-21)23-15-16-6-4-7-18(14-16)24-22(25)17-9-11-19(26-2)12-10-17/h1,4,6-7,9-12,14,20-21,23H,5,8,13,15H2,2H3,(H,24,25)/t20-,21-/m1/s1 |
| InChIKey | CJVBMIPENOLHNQ-NHCUHLMSSA-N |
| XLogP | 3.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|