About 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole
1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole (PubChem CID 124727108) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole.
Molecular Properties
| Compound Name | 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole |
| PubChem CID | 124727108 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole |
| SMILES | COc1ccnc(CN2CC[C@H](n3ncc4ccccc43)C2)c1OC |
| InChI | InChI=1S/C19H22N4O2/c1-24-18-7-9-20-16(19(18)25-2)13-22-10-8-15(12-22)23-17-6-4-3-5-14(17)11-21-23/h3-7,9,11,15H,8,10,12-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | COKWDTPRMFLWER-HNNXBMFYSA-N |
| XLogP | 2.90 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole?
The IUPAC name of 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole (CID 124727108) is 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole.
What is the SMILES notation for 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole?
The canonical SMILES for 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole is COc1ccnc(CN2CC[C@H](n3ncc4ccccc43)C2)c1OC.
What is the InChIKey of 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole?
The InChIKey is COKWDTPRMFLWER-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H22N4O2/c1-24-18-7-9-20-16(19(18)25-2)13-22-10-8-15(12-22)23-17-6-4-3-5-14(17)11-21-23/h3-7,9,11,15H,8,10,12-13H2,1-2H3/t15-/m0/s1.
What are the key properties of 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole?
1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole has a molecular weight of 338.41 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]pyrrolidin-3-yl]indazole is sourced from PubChem (CID 124727108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).