C15H19N3O3 — CID 124727509
3-[2-[(2R)-2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 124727509) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-[2-[(2R)-2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[(2R)-2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124727509 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-[2-[(2R)-2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)N(CCN1C(=O)CNC1=O)C[C@@H](C)O2 |
| InChI | InChI=1S/C15H19N3O3/c1-10-3-4-13-12(7-10)17(9-11(2)21-13)5-6-18-14(19)8-16-15(18)20/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | DAFQENDTEVTPRZ-LLVKDONJSA-N |
| XLogP | 1.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|